C11H11ClFNO4S — CID 138031784
3-[(3-chloro-5-fluorophenyl)sulfonylamino]cyclobutane-1-carboxylic acid (PubChem CID 138031784) has the molecular formula C11H11ClFNO4S and a molecular weight of 307.73 g/mol. Its IUPAC name is 3-[(3-chloro-5-fluorophenyl)sulfonylamino]cyclobutane-1-carboxylic acid.
| Compound Name | 3-[(3-chloro-5-fluorophenyl)sulfonylamino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 138031784 |
| Molecular Formula | C11H11ClFNO4S |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 3-[(3-chloro-5-fluorophenyl)sulfonylamino]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CC(NS(=O)(=O)c2cc(F)cc(Cl)c2)C1 |
| InChI | InChI=1S/C11H11ClFNO4S/c12-7-3-8(13)5-10(4-7)19(17,18)14-9-1-6(2-9)11(15)16/h3-6,9,14H,1-2H2,(H,15,16) |
| InChIKey | HYZSPMLGUXQXLA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |