C10H12F2N2O2S — CID 43597821
N-(3-aminocyclobutyl)-3,5-difluorobenzenesulfonamide (PubChem CID 43597821) has the molecular formula C10H12F2N2O2S and a molecular weight of 262.28 g/mol. Its IUPAC name is N-(3-aminocyclobutyl)-3,5-difluorobenzenesulfonamide.
| Compound Name | N-(3-aminocyclobutyl)-3,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 43597821 |
| Molecular Formula | C10H12F2N2O2S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | N-(3-aminocyclobutyl)-3,5-difluorobenzenesulfonamide |
| SMILES | NC1CC(NS(=O)(=O)c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C10H12F2N2O2S/c11-6-1-7(12)3-10(2-6)17(15,16)14-9-4-8(13)5-9/h1-3,8-9,14H,4-5,13H2 |
| InChIKey | ILOXNKJNTOEFOE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |