C11H13ClF2N2O3S — CID 43597890
N-(3-aminocyclobutyl)-3-chloro-4-(difluoromethoxy)benzenesulfonamide (PubChem CID 43597890) has the molecular formula C11H13ClF2N2O3S and a molecular weight of 326.75 g/mol. Its IUPAC name is N-(3-aminocyclobutyl)-3-chloro-4-(difluoromethoxy)benzenesulfonamide.
| Compound Name | N-(3-aminocyclobutyl)-3-chloro-4-(difluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 43597890 |
| Molecular Formula | C11H13ClF2N2O3S |
| Molecular Weight | 326.75 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | N-(3-aminocyclobutyl)-3-chloro-4-(difluoromethoxy)benzenesulfonamide |
| SMILES | NC1CC(NS(=O)(=O)c2ccc(OC(F)F)c(Cl)c2)C1 |
| InChI | InChI=1S/C11H13ClF2N2O3S/c12-9-5-8(1-2-10(9)19-11(13)14)20(17,18)16-7-3-6(15)4-7/h1-2,5-7,11,16H,3-4,15H2 |
| InChIKey | VIDIMWZEBOFKIX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.75 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |