C9H9F2NO2S — CID 60648847
N-cyclopropyl-3,5-difluorobenzenesulfonamide (PubChem CID 60648847) has the molecular formula C9H9F2NO2S and a molecular weight of 233.24 g/mol. Its IUPAC name is N-cyclopropyl-3,5-difluorobenzenesulfonamide.
| Compound Name | N-cyclopropyl-3,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 60648847 |
| Molecular Formula | C9H9F2NO2S |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | N-cyclopropyl-3,5-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1CC1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C9H9F2NO2S/c10-6-3-7(11)5-9(4-6)15(13,14)12-8-1-2-8/h3-5,8,12H,1-2H2 |
| InChIKey | BBUNVYJVBAKVEH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |