C13H17ClFNO4S — CID 120660622
2-[[(3-chloro-5-fluorophenyl)sulfonylamino]methyl]-4-methylpentanoic acid (PubChem CID 120660622) has the molecular formula C13H17ClFNO4S and a molecular weight of 337.80 g/mol. Its IUPAC name is 2-[[(3-chloro-5-fluorophenyl)sulfonylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[(3-chloro-5-fluorophenyl)sulfonylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120660622 |
| Molecular Formula | C13H17ClFNO4S |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 2-[[(3-chloro-5-fluorophenyl)sulfonylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNS(=O)(=O)c1cc(F)cc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C13H17ClFNO4S/c1-8(2)3-9(13(17)18)7-16-21(19,20)12-5-10(14)4-11(15)6-12/h4-6,8-9,16H,3,7H2,1-2H3,(H,17,18) |
| InChIKey | LWCRPKVGNCGEHV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |