C16H20N2O6S — CID 120660441
4-methyl-2-[[(2-methyl-1,3-dioxoisoindol-5-yl)sulfonylamino]methyl]pentanoic acid (PubChem CID 120660441) has the molecular formula C16H20N2O6S and a molecular weight of 368.41 g/mol. Its IUPAC name is 4-methyl-2-[[(2-methyl-1,3-dioxoisoindol-5-yl)sulfonylamino]methyl]pentanoic acid.
| Compound Name | 4-methyl-2-[[(2-methyl-1,3-dioxoisoindol-5-yl)sulfonylamino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 120660441 |
| Molecular Formula | C16H20N2O6S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 4-methyl-2-[[(2-methyl-1,3-dioxoisoindol-5-yl)sulfonylamino]methyl]pentanoic acid |
| SMILES | CC(C)CC(CNS(=O)(=O)c1ccc2c(c1)C(=O)N(C)C2=O)C(=O)O |
| InChI | InChI=1S/C16H20N2O6S/c1-9(2)6-10(16(21)22)8-17-25(23,24)11-4-5-12-13(7-11)15(20)18(3)14(12)19/h4-5,7,9-10,17H,6,8H2,1-3H3,(H,21,22) |
| InChIKey | PSGIXEPGVLOVSB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|