C13H23N3O5S — CID 120660417
2-[[[1-(2-methoxyethyl)pyrazol-4-yl]sulfonylamino]methyl]-4-methylpentanoic acid (PubChem CID 120660417) has the molecular formula C13H23N3O5S and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-[[[1-(2-methoxyethyl)pyrazol-4-yl]sulfonylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[[1-(2-methoxyethyl)pyrazol-4-yl]sulfonylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120660417 |
| Molecular Formula | C13H23N3O5S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 2-[[[1-(2-methoxyethyl)pyrazol-4-yl]sulfonylamino]methyl]-4-methylpentanoic acid |
| SMILES | COCCn1cc(S(=O)(=O)NCC(CC(C)C)C(=O)O)cn1 |
| InChI | InChI=1S/C13H23N3O5S/c1-10(2)6-11(13(17)18)7-15-22(19,20)12-8-14-16(9-12)4-5-21-3/h8-11,15H,4-7H2,1-3H3,(H,17,18) |
| InChIKey | OEXHYESRSUTITP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |