C9H17N3O3S2 — CID 114135391
1-(2-hydroxyethyl)-N-(2-methylsulfanylpropyl)pyrazole-4-sulfonamide (PubChem CID 114135391) has the molecular formula C9H17N3O3S2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-N-(2-methylsulfanylpropyl)pyrazole-4-sulfonamide.
| Compound Name | 1-(2-hydroxyethyl)-N-(2-methylsulfanylpropyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 114135391 |
| Molecular Formula | C9H17N3O3S2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 1-(2-hydroxyethyl)-N-(2-methylsulfanylpropyl)pyrazole-4-sulfonamide |
| SMILES | CSC(C)CNS(=O)(=O)c1cnn(CCO)c1 |
| InChI | InChI=1S/C9H17N3O3S2/c1-8(16-2)5-11-17(14,15)9-6-10-12(7-9)3-4-13/h6-8,11,13H,3-5H2,1-2H3 |
| InChIKey | HHYANAPFFBRZKI-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |