C10H19N3O3S2 — CID 114135493
1-(2-hydroxyethyl)-N-(2-methyl-2-methylsulfanylpropyl)pyrazole-4-sulfonamide (PubChem CID 114135493) has the molecular formula C10H19N3O3S2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-N-(2-methyl-2-methylsulfanylpropyl)pyrazole-4-sulfonamide.
| Compound Name | 1-(2-hydroxyethyl)-N-(2-methyl-2-methylsulfanylpropyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 114135493 |
| Molecular Formula | C10H19N3O3S2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1-(2-hydroxyethyl)-N-(2-methyl-2-methylsulfanylpropyl)pyrazole-4-sulfonamide |
| SMILES | CSC(C)(C)CNS(=O)(=O)c1cnn(CCO)c1 |
| InChI | InChI=1S/C10H19N3O3S2/c1-10(2,17-3)8-12-18(15,16)9-6-11-13(7-9)4-5-14/h6-7,12,14H,4-5,8H2,1-3H3 |
| InChIKey | FHHWISXAJNAFEX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |