C11H19N3O3S2 — CID 106002272
1-(3-hydroxypropyl)-N-[(1-methylsulfanylcyclopropyl)methyl]pyrazole-4-sulfonamide (PubChem CID 106002272) has the molecular formula C11H19N3O3S2 and a molecular weight of 305.43 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-N-[(1-methylsulfanylcyclopropyl)methyl]pyrazole-4-sulfonamide.
| Compound Name | 1-(3-hydroxypropyl)-N-[(1-methylsulfanylcyclopropyl)methyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106002272 |
| Molecular Formula | C11H19N3O3S2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 1-(3-hydroxypropyl)-N-[(1-methylsulfanylcyclopropyl)methyl]pyrazole-4-sulfonamide |
| SMILES | CSC1(CNS(=O)(=O)c2cnn(CCCO)c2)CC1 |
| InChI | InChI=1S/C11H19N3O3S2/c1-18-11(3-4-11)9-13-19(16,17)10-7-12-14(8-10)5-2-6-15/h7-8,13,15H,2-6,9H2,1H3 |
| InChIKey | GIFVEDJTXQUPNB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |