C13H23N3O3S2 — CID 106001861
1-(2-hydroxyethyl)-N-[(1-methylsulfanylcyclohexyl)methyl]pyrazole-4-sulfonamide (PubChem CID 106001861) has the molecular formula C13H23N3O3S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-N-[(1-methylsulfanylcyclohexyl)methyl]pyrazole-4-sulfonamide.
| Compound Name | 1-(2-hydroxyethyl)-N-[(1-methylsulfanylcyclohexyl)methyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106001861 |
| Molecular Formula | C13H23N3O3S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-(2-hydroxyethyl)-N-[(1-methylsulfanylcyclohexyl)methyl]pyrazole-4-sulfonamide |
| SMILES | CSC1(CNS(=O)(=O)c2cnn(CCO)c2)CCCCC1 |
| InChI | InChI=1S/C13H23N3O3S2/c1-20-13(5-3-2-4-6-13)11-15-21(18,19)12-9-14-16(10-12)7-8-17/h9-10,15,17H,2-8,11H2,1H3 |
| InChIKey | CBXSWUOMSYYTKN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |