C11H21ClN4O2S — CID 71894825
N-[(1-aminocyclohexyl)methyl]-1-methylpyrazole-4-sulfonamide;hydrochloride (PubChem CID 71894825) has the molecular formula C11H21ClN4O2S and a molecular weight of 308.83 g/mol. Its IUPAC name is N-[(1-aminocyclohexyl)methyl]-1-methylpyrazole-4-sulfonamide;hydrochloride.
| Compound Name | N-[(1-aminocyclohexyl)methyl]-1-methylpyrazole-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 71894825 |
| Molecular Formula | C11H21ClN4O2S |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N-[(1-aminocyclohexyl)methyl]-1-methylpyrazole-4-sulfonamide;hydrochloride |
| SMILES | Cl.Cn1cc(S(=O)(=O)NCC2(N)CCCCC2)cn1 |
| InChI | InChI=1S/C11H20N4O2S.ClH/c1-15-8-10(7-13-15)18(16,17)14-9-11(12)5-3-2-4-6-11;/h7-8,14H,2-6,9,12H2,1H3;1H |
| InChIKey | GYQWBOJUHDPDGH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |