C13H22N4O3S — CID 139028911
1-methyl-N-[(1-morpholin-4-ylcyclobutyl)methyl]pyrazole-4-sulfonamide (PubChem CID 139028911) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 1-methyl-N-[(1-morpholin-4-ylcyclobutyl)methyl]pyrazole-4-sulfonamide.
| Compound Name | 1-methyl-N-[(1-morpholin-4-ylcyclobutyl)methyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 139028911 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-methyl-N-[(1-morpholin-4-ylcyclobutyl)methyl]pyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCC2(N3CCOCC3)CCC2)cn1 |
| InChI | InChI=1S/C13H22N4O3S/c1-16-10-12(9-14-16)21(18,19)15-11-13(3-2-4-13)17-5-7-20-8-6-17/h9-10,15H,2-8,11H2,1H3 |
| InChIKey | LDKCWVAROPWUNH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |