C9H14ClN3O2S — CID 115456681
N-[[1-(chloromethyl)cyclopropyl]methyl]-1-methylpyrazole-4-sulfonamide (PubChem CID 115456681) has the molecular formula C9H14ClN3O2S and a molecular weight of 263.75 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclopropyl]methyl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-[[1-(chloromethyl)cyclopropyl]methyl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115456681 |
| Molecular Formula | C9H14ClN3O2S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | N-[[1-(chloromethyl)cyclopropyl]methyl]-1-methylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCC2(CCl)CC2)cn1 |
| InChI | InChI=1S/C9H14ClN3O2S/c1-13-5-8(4-11-13)16(14,15)12-7-9(6-10)2-3-9/h4-5,12H,2-3,6-7H2,1H3 |
| InChIKey | DFVVNSRWNPSPMO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|