C13H17N3O4S — CID 119965032
2-methyl-N-[3-(methylamino)propyl]-1,3-dioxoisoindole-5-sulfonamide (PubChem CID 119965032) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-methyl-N-[3-(methylamino)propyl]-1,3-dioxoisoindole-5-sulfonamide.
| Compound Name | 2-methyl-N-[3-(methylamino)propyl]-1,3-dioxoisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 119965032 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-methyl-N-[3-(methylamino)propyl]-1,3-dioxoisoindole-5-sulfonamide |
| SMILES | CNCCCNS(=O)(=O)c1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C13H17N3O4S/c1-14-6-3-7-15-21(19,20)9-4-5-10-11(8-9)13(18)16(2)12(10)17/h4-5,8,14-15H,3,6-7H2,1-2H3 |
| InChIKey | WNDVFKPWWUUXTM-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|