C16H21N3O4S — CID 119978462
2-methyl-5-[4-(methylaminomethyl)piperidin-1-yl]sulfonylisoindole-1,3-dione (PubChem CID 119978462) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-methyl-5-[4-(methylaminomethyl)piperidin-1-yl]sulfonylisoindole-1,3-dione.
| Compound Name | 2-methyl-5-[4-(methylaminomethyl)piperidin-1-yl]sulfonylisoindole-1,3-dione |
|---|---|
| PubChem CID | 119978462 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-methyl-5-[4-(methylaminomethyl)piperidin-1-yl]sulfonylisoindole-1,3-dione |
| SMILES | CNCC1CCN(S(=O)(=O)c2ccc3c(c2)C(=O)N(C)C3=O)CC1 |
| InChI | InChI=1S/C16H21N3O4S/c1-17-10-11-5-7-19(8-6-11)24(22,23)12-3-4-13-14(9-12)16(21)18(2)15(13)20/h3-4,9,11,17H,5-8,10H2,1-2H3 |
| InChIKey | RRWDVZVDZBFZGI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|