C17H21BrN2O2S — CID 120709764
1-[1-(6-bromonaphthalen-2-yl)sulfonylpiperidin-4-yl]-N-methylmethanamine (PubChem CID 120709764) has the molecular formula C17H21BrN2O2S and a molecular weight of 397.34 g/mol. Its IUPAC name is 1-[1-(6-bromonaphthalen-2-yl)sulfonylpiperidin-4-yl]-N-methylmethanamine.
| Compound Name | 1-[1-(6-bromonaphthalen-2-yl)sulfonylpiperidin-4-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 120709764 |
| Molecular Formula | C17H21BrN2O2S |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 1-[1-(6-bromonaphthalen-2-yl)sulfonylpiperidin-4-yl]-N-methylmethanamine |
| SMILES | CNCC1CCN(S(=O)(=O)c2ccc3cc(Br)ccc3c2)CC1 |
| InChI | InChI=1S/C17H21BrN2O2S/c1-19-12-13-6-8-20(9-7-13)23(21,22)17-5-3-14-10-16(18)4-2-15(14)11-17/h2-5,10-11,13,19H,6-9,12H2,1H3 |
| InChIKey | QXGMTKAHLOKLJM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |