C19H20N2O5S — CID 71852824
N-(4-hydroxy-4-phenylbutan-2-yl)-2-methyl-1,3-dioxoisoindole-5-sulfonamide (PubChem CID 71852824) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-(4-hydroxy-4-phenylbutan-2-yl)-2-methyl-1,3-dioxoisoindole-5-sulfonamide.
| Compound Name | N-(4-hydroxy-4-phenylbutan-2-yl)-2-methyl-1,3-dioxoisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 71852824 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-(4-hydroxy-4-phenylbutan-2-yl)-2-methyl-1,3-dioxoisoindole-5-sulfonamide |
| SMILES | CC(CC(O)c1ccccc1)NS(=O)(=O)c1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C19H20N2O5S/c1-12(10-17(22)13-6-4-3-5-7-13)20-27(25,26)14-8-9-15-16(11-14)19(24)21(2)18(15)23/h3-9,11-12,17,20,22H,10H2,1-2H3 |
| InChIKey | XKDYPFIMRCXQNC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|