C16H18ClNO4S — CID 97241463
3-chloro-N-[(2R,4S)-1,4-dihydroxy-4-phenylbutan-2-yl]benzenesulfonamide (PubChem CID 97241463) has the molecular formula C16H18ClNO4S and a molecular weight of 355.84 g/mol. Its IUPAC name is 3-chloro-N-[(2R,4S)-1,4-dihydroxy-4-phenylbutan-2-yl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[(2R,4S)-1,4-dihydroxy-4-phenylbutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 97241463 |
| Molecular Formula | C16H18ClNO4S |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 3-chloro-N-[(2R,4S)-1,4-dihydroxy-4-phenylbutan-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H](CO)C[C@H](O)c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H18ClNO4S/c17-13-7-4-8-15(9-13)23(21,22)18-14(11-19)10-16(20)12-5-2-1-3-6-12/h1-9,14,16,18-20H,10-11H2/t14-,16+/m1/s1 |
| InChIKey | TTWDJMSNJAYDIS-ZBFHGGJFSA-N |
| XLogP | 2.10 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |