C14H18BrCl2NO2S — CID 114295411
N-[[2-(bromomethyl)cyclohexyl]methyl]-3,5-dichlorobenzenesulfonamide (PubChem CID 114295411) has the molecular formula C14H18BrCl2NO2S and a molecular weight of 415.18 g/mol. Its IUPAC name is N-[[2-(bromomethyl)cyclohexyl]methyl]-3,5-dichlorobenzenesulfonamide.
| Compound Name | N-[[2-(bromomethyl)cyclohexyl]methyl]-3,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 114295411 |
| Molecular Formula | C14H18BrCl2NO2S |
| Molecular Weight | 415.18 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | N-[[2-(bromomethyl)cyclohexyl]methyl]-3,5-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCCC1CBr)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H18BrCl2NO2S/c15-8-10-3-1-2-4-11(10)9-18-21(19,20)14-6-12(16)5-13(17)7-14/h5-7,10-11,18H,1-4,8-9H2 |
| InChIKey | WBMDKAYIJXBFDB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.18 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|