C14H19Br2NO2S — CID 114295394
3-bromo-N-[[2-(bromomethyl)cyclohexyl]methyl]benzenesulfonamide (PubChem CID 114295394) has the molecular formula C14H19Br2NO2S and a molecular weight of 425.19 g/mol. Its IUPAC name is 3-bromo-N-[[2-(bromomethyl)cyclohexyl]methyl]benzenesulfonamide.
| Compound Name | 3-bromo-N-[[2-(bromomethyl)cyclohexyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 114295394 |
| Molecular Formula | C14H19Br2NO2S |
| Molecular Weight | 425.19 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | 3-bromo-N-[[2-(bromomethyl)cyclohexyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCCC1CBr)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H19Br2NO2S/c15-9-11-4-1-2-5-12(11)10-17-20(18,19)14-7-3-6-13(16)8-14/h3,6-8,11-12,17H,1-2,4-5,9-10H2 |
| InChIKey | SJQHSJDEPUPFAZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.19 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|