C15H22BrNO2S — CID 63422973
3-bromo-N-[(4-ethylcyclohexyl)methyl]benzenesulfonamide (PubChem CID 63422973) has the molecular formula C15H22BrNO2S and a molecular weight of 360.32 g/mol. Its IUPAC name is 3-bromo-N-[(4-ethylcyclohexyl)methyl]benzenesulfonamide.
| Compound Name | 3-bromo-N-[(4-ethylcyclohexyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63422973 |
| Molecular Formula | C15H22BrNO2S |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 3-bromo-N-[(4-ethylcyclohexyl)methyl]benzenesulfonamide |
| SMILES | CCC1CCC(CNS(=O)(=O)c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C15H22BrNO2S/c1-2-12-6-8-13(9-7-12)11-17-20(18,19)15-5-3-4-14(16)10-15/h3-5,10,12-13,17H,2,6-9,11H2,1H3 |
| InChIKey | IXVUZSJUDOJFTI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |