C8H17NO — CID 138485251
cis-(1S,2S)-1-methyl-2-(methylamino)cyclohexan-1-ol (PubChem CID 138485251) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is cis-(1S,2S)-1-methyl-2-(methylamino)cyclohexan-1-ol.
| Compound Name | cis-(1S,2S)-1-methyl-2-(methylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 138485251 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | cis-(1S,2S)-1-methyl-2-(methylamino)cyclohexan-1-ol |
| SMILES | CN[C@H]1CCCC[C@]1(C)O |
| InChI | InChI=1S/C8H17NO/c1-8(10)6-4-3-5-7(8)9-2/h7,9-10H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | KMMPFGUVUKURFE-YUMQZZPRSA-N |
| XLogP | 0.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |