About 2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride
2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride (PubChem CID 172765796) has the molecular formula C8H19ClN2
and a molecular weight of 178.71 g/mol. Its IUPAC name is 2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride |
| PubChem CID | 172765796 |
| Molecular Formula | C8H19ClN2 |
| Molecular Weight | 178.71 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride |
| SMILES | CNC1CCCCC1(C)N.Cl |
| InChI | InChI=1S/C8H18N2.ClH/c1-8(9)6-4-3-5-7(8)10-2;/h7,10H,3-6,9H2,1-2H3;1H |
| InChIKey | MHHVBLZAZRSRMZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.71 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride?
The IUPAC name of 2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride (CID 172765796) is 2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride.
What is the SMILES notation for 2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride?
The canonical SMILES for 2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride is CNC1CCCCC1(C)N.Cl.
What is the InChIKey of 2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride?
The InChIKey is MHHVBLZAZRSRMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2.ClH/c1-8(9)6-4-3-5-7(8)10-2;/h7,10H,3-6,9H2,1-2H3;1H.
What are the key properties of 2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride?
2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride has a molecular weight of 178.71 g/mol, XLogP of 1.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,1-dimethylcyclohexane-1,2-diamine;hydrochloride is sourced from PubChem (CID 172765796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).