C8H19ClN2 — CID 86811831
(2,2-dimethylcyclohexyl)hydrazine;hydrochloride (PubChem CID 86811831) has the molecular formula C8H19ClN2 and a molecular weight of 178.71 g/mol. Its IUPAC name is (2,2-dimethylcyclohexyl)hydrazine;hydrochloride.
| Compound Name | (2,2-dimethylcyclohexyl)hydrazine;hydrochloride |
|---|---|
| PubChem CID | 86811831 |
| Molecular Formula | C8H19ClN2 |
| Molecular Weight | 178.71 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | (2,2-dimethylcyclohexyl)hydrazine;hydrochloride |
| SMILES | CC1(C)CCCCC1NN.Cl |
| InChI | InChI=1S/C8H18N2.ClH/c1-8(2)6-4-3-5-7(8)10-9;/h7,10H,3-6,9H2,1-2H3;1H |
| InChIKey | VNYAZBNEROFAJA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.71 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|