C11H23NO2 — CID 79836294
2-[(2,2-dimethylcyclohexyl)amino]propane-1,3-diol (PubChem CID 79836294) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-[(2,2-dimethylcyclohexyl)amino]propane-1,3-diol.
| Compound Name | 2-[(2,2-dimethylcyclohexyl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 79836294 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 2-[(2,2-dimethylcyclohexyl)amino]propane-1,3-diol |
| SMILES | CC1(C)CCCCC1NC(CO)CO |
| InChI | InChI=1S/C11H23NO2/c1-11(2)6-4-3-5-10(11)12-9(7-13)8-14/h9-10,12-14H,3-8H2,1-2H3 |
| InChIKey | RHQTYLCKPDKPHL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |