C19H24O2 — CID 56924130
(9R,10S,13S)-10,13-dimethyl-2,3,4,5,6,9,11,12-octahydro-1H-cyclopenta[a]phenanthrene-16,17-dione (PubChem CID 56924130) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (9R,10S,13S)-10,13-dimethyl-2,3,4,5,6,9,11,12-octahydro-1H-cyclopenta[a]phenanthrene-16,17-dione.
| Compound Name | (9R,10S,13S)-10,13-dimethyl-2,3,4,5,6,9,11,12-octahydro-1H-cyclopenta[a]phenanthrene-16,17-dione |
|---|---|
| PubChem CID | 56924130 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (9R,10S,13S)-10,13-dimethyl-2,3,4,5,6,9,11,12-octahydro-1H-cyclopenta[a]phenanthrene-16,17-dione |
| SMILES | C[C@]12CC[C@H]3C(=CCC4CCCC[C@@]43C)C1=CC(=O)C2=O |
| InChI | InChI=1S/C19H24O2/c1-18-9-4-3-5-12(18)6-7-13-14(18)8-10-19(2)15(13)11-16(20)17(19)21/h7,11-12,14H,3-6,8-10H2,1-2H3/t12?,14-,18-,19-/m0/s1 |
| InChIKey | OOHCFHQOGBUDII-ALMLVCHBSA-N |
| XLogP | 4.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|