C23H34O3 — CID 161157791
(9R,10S,13S)-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12-decahydrocyclopenta[a]phenanthren-17-one;2-methylprop-2-ene-1,1-diol (PubChem CID 161157791) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (9R,10S,13S)-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12-decahydrocyclopenta[a]phenanthren-17-one;2-methylprop-2-ene-1,1-diol.
| Compound Name | (9R,10S,13S)-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12-decahydrocyclopenta[a]phenanthren-17-one;2-methylprop-2-ene-1,1-diol |
|---|---|
| PubChem CID | 161157791 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (9R,10S,13S)-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12-decahydrocyclopenta[a]phenanthren-17-one;2-methylprop-2-ene-1,1-diol |
| SMILES | C=C(C)C(O)O.C[C@]12CC[C@H]3C(=C1C=CC2=O)CCC1CCCC[C@@]13C |
| InChI | InChI=1S/C19H26O.C4H8O2/c1-18-11-4-3-5-13(18)6-7-14-15-8-9-17(20)19(15,2)12-10-16(14)18;1-3(2)4(5)6/h8-9,13,16H,3-7,10-12H2,1-2H3;4-6H,1H2,2H3/t13?,16-,18-,19-;/m0./s1 |
| InChIKey | UPNGRBLIDYLAJW-BOFICLDNSA-N |
| XLogP | 4.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|