C28H46O3 — CID 141282586
(3R,6R)-6-[(9R,10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3-dimethylhept-4-ene-1,1,1-triol (PubChem CID 141282586) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is (3R,6R)-6-[(9R,10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3-dimethylhept-4-ene-1,1,1-triol.
| Compound Name | (3R,6R)-6-[(9R,10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3-dimethylhept-4-ene-1,1,1-triol |
|---|---|
| PubChem CID | 141282586 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | (3R,6R)-6-[(9R,10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3-dimethylhept-4-ene-1,1,1-triol |
| SMILES | CC([C@H](C)C=C[C@@H](C)[C@H]1CCC2=C3CCC4CCCC[C@]4(C)[C@H]3CC[C@@]21C)C(O)(O)O |
| InChI | InChI=1S/C28H46O3/c1-18(20(3)28(29,30)31)9-10-19(2)23-13-14-24-22-12-11-21-8-6-7-16-26(21,4)25(22)15-17-27(23,24)5/h9-10,18-21,23,25,29-31H,6-8,11-17H2,1-5H3/t18-,19-,20?,21?,23-,25+,26+,27-/m1/s1 |
| InChIKey | XGIXFCZCRAKBSO-JQYKLDHQSA-N |
| XLogP | 6.19 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|