C28H44O4 — CID 22804290
[(1S)-1-[(5S,9S,10R,13R,17S)-10-(acetyloxymethyl)-13-methyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] 2,2-dimethylpropanoate (PubChem CID 22804290) has the molecular formula C28H44O4 and a molecular weight of 444.66 g/mol. Its IUPAC name is [(1S)-1-[(5S,9S,10R,13R,17S)-10-(acetyloxymethyl)-13-methyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] 2,2-dimethylpropanoate.
| Compound Name | [(1S)-1-[(5S,9S,10R,13R,17S)-10-(acetyloxymethyl)-13-methyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 22804290 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | [(1S)-1-[(5S,9S,10R,13R,17S)-10-(acetyloxymethyl)-13-methyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] 2,2-dimethylpropanoate |
| SMILES | CC(=O)OC[C@]12CCCC[C@H]1CCC1=C3CC[C@H]([C@H](C)OC(=O)C(C)(C)C)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C28H44O4/c1-18(32-25(30)26(3,4)5)22-12-13-23-21-11-10-20-9-7-8-15-28(20,17-31-19(2)29)24(21)14-16-27(22,23)6/h18,20,22,24H,7-17H2,1-6H3/t18-,20-,22+,24-,27+,28+/m0/s1 |
| InChIKey | IVPOZOCDYPSSSS-YGHOSOKCSA-N |
| XLogP | 6.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|