C26H42O4 — CID 88810816
1-[(8R,9S,10S,13R,14R,17S)-10-formyl-14-hydroxy-13-methyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 88810816) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is 1-[(8R,9S,10S,13R,14R,17S)-10-formyl-14-hydroxy-13-methyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 1-[(8R,9S,10S,13R,14R,17S)-10-formyl-14-hydroxy-13-methyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 88810816 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | 1-[(8R,9S,10S,13R,14R,17S)-10-formyl-14-hydroxy-13-methyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(OC(=O)C(C)(C)C)[C@H]1CC[C@@]2(O)[C@@H]3CCC4CCCC[C@@]4(C=O)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H42O4/c1-17(30-22(28)23(2,3)4)19-12-15-26(29)21-10-9-18-8-6-7-13-25(18,16-27)20(21)11-14-24(19,26)5/h16-21,29H,6-15H2,1-5H3/t17?,18?,19-,20+,21-,24-,25+,26-/m1/s1 |
| InChIKey | RBCQBLXJGVQOAV-YXNKTPBRSA-N |
| XLogP | 5.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|