C23H31NO7 — CID 124900539
[(3R,5R,8S,9S,10R,13R,14R,17R)-10-formyl-14-hydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] nitrate (PubChem CID 124900539) has the molecular formula C23H31NO7 and a molecular weight of 433.50 g/mol. Its IUPAC name is [(3R,5R,8S,9S,10R,13R,14R,17R)-10-formyl-14-hydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] nitrate.
| Compound Name | [(3R,5R,8S,9S,10R,13R,14R,17R)-10-formyl-14-hydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] nitrate |
|---|---|
| PubChem CID | 124900539 |
| Molecular Formula | C23H31NO7 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | [(3R,5R,8S,9S,10R,13R,14R,17R)-10-formyl-14-hydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] nitrate |
| SMILES | C[C@]12CC[C@H]3[C@H](CC[C@@H]4C[C@H](O[N+](=O)[O-])CC[C@@]43C=O)[C@]1(O)CC[C@@H]2C1=CC(=O)OC1 |
| InChI | InChI=1S/C23H31NO7/c1-21-7-5-18-19(23(21,27)9-6-17(21)14-10-20(26)30-12-14)3-2-15-11-16(31-24(28)29)4-8-22(15,18)13-25/h10,13,15-19,27H,2-9,11-12H2,1H3/t15-,16-,17-,18+,19+,21-,22-,23-/m1/s1 |
| InChIKey | RJAUVGPQRJIERL-IPLZGNEYSA-N |
| XLogP | 3.00 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|