C23H32O8S — CID 45379228
[(3S,5R,8R,9S,10R,13R,14S,17R)-10-formyl-14-hydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate (PubChem CID 45379228) has the molecular formula C23H32O8S and a molecular weight of 468.57 g/mol. Its IUPAC name is [(3S,5R,8R,9S,10R,13R,14S,17R)-10-formyl-14-hydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate.
| Compound Name | [(3S,5R,8R,9S,10R,13R,14S,17R)-10-formyl-14-hydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 45379228 |
| Molecular Formula | C23H32O8S |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | [(3S,5R,8R,9S,10R,13R,14S,17R)-10-formyl-14-hydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@@H](OS(=O)(=O)O)CC[C@@]43C=O)[C@@]1(O)CC[C@@H]2C1=CC(=O)OC1 |
| InChI | InChI=1S/C23H32O8S/c1-21-7-5-18-19(23(21,26)9-6-17(21)14-10-20(25)30-12-14)3-2-15-11-16(31-32(27,28)29)4-8-22(15,18)13-24/h10,13,15-19,26H,2-9,11-12H2,1H3,(H,27,28,29)/t15-,16+,17-,18+,19-,21-,22-,23+/m1/s1 |
| InChIKey | LQKIRCWMZFJFKX-NNNAONFXSA-N |
| XLogP | 2.61 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|