C26H42O3 — CID 70602423
1-[(9S,10R,13R,17S)-10-(hydroxymethyl)-13-methyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 70602423) has the molecular formula C26H42O3 and a molecular weight of 402.62 g/mol. Its IUPAC name is 1-[(9S,10R,13R,17S)-10-(hydroxymethyl)-13-methyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 1-[(9S,10R,13R,17S)-10-(hydroxymethyl)-13-methyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 70602423 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 1-[(9S,10R,13R,17S)-10-(hydroxymethyl)-13-methyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(OC(=O)C(C)(C)C)[C@H]1CCC2=C3CCC4CCCC[C@]4(CO)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C26H42O3/c1-17(29-23(28)24(2,3)4)20-11-12-21-19-10-9-18-8-6-7-14-26(18,16-27)22(19)13-15-25(20,21)5/h17-18,20,22,27H,6-16H2,1-5H3/t17?,18?,20-,22+,25-,26-/m1/s1 |
| InChIKey | JDHYZVOACWNFPX-DRMMQWEOSA-N |
| XLogP | 6.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|