C19H30O — CID 122676879
(4aS,6aR,7aS,10aS,11aR,11bR)-7a,11b-dimethyl-1,2,3,4,4a,5,6,6a,7,9,10,10a,11,11a-tetradecahydrocyclopenta[b]phenanthren-8-one (PubChem CID 122676879) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (4aS,6aR,7aS,10aS,11aR,11bR)-7a,11b-dimethyl-1,2,3,4,4a,5,6,6a,7,9,10,10a,11,11a-tetradecahydrocyclopenta[b]phenanthren-8-one.
| Compound Name | (4aS,6aR,7aS,10aS,11aR,11bR)-7a,11b-dimethyl-1,2,3,4,4a,5,6,6a,7,9,10,10a,11,11a-tetradecahydrocyclopenta[b]phenanthren-8-one |
|---|---|
| PubChem CID | 122676879 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (4aS,6aR,7aS,10aS,11aR,11bR)-7a,11b-dimethyl-1,2,3,4,4a,5,6,6a,7,9,10,10a,11,11a-tetradecahydrocyclopenta[b]phenanthren-8-one |
| SMILES | C[C@@]12CCCC[C@H]1CC[C@@H]1C[C@]3(C)C(=O)CC[C@H]3C[C@H]12 |
| InChI | InChI=1S/C19H30O/c1-18-10-4-3-5-14(18)7-6-13-12-19(2)15(11-16(13)18)8-9-17(19)20/h13-16H,3-12H2,1-2H3/t13-,14+,15+,16-,18-,19+/m1/s1 |
| InChIKey | DECBGQVVDKVBCD-XNYUJGFBSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |