C18H27ClO — CID 134354077
(10S,13R)-13-chloro-10-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 134354077) has the molecular formula C18H27ClO and a molecular weight of 294.87 g/mol. Its IUPAC name is (10S,13R)-13-chloro-10-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (10S,13R)-13-chloro-10-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 134354077 |
| Molecular Formula | C18H27ClO |
| Molecular Weight | 294.87 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (10S,13R)-13-chloro-10-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCCCC1CCC1C2CC[C@]2(Cl)C(=O)CCC12 |
| InChI | InChI=1S/C18H27ClO/c1-17-10-3-2-4-12(17)5-6-13-14(17)9-11-18(19)15(13)7-8-16(18)20/h12-15H,2-11H2,1H3/t12?,13?,14?,15?,17-,18+/m0/s1 |
| InChIKey | SBTSUXILDFUWRR-MPGAVKBHSA-N |
| XLogP | 4.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.87 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|