C21H34O2 — CID 69133264
(8R,9S,10S,13S,14S)-13-(1-methoxyethyl)-10-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 69133264) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-13-(1-methoxyethyl)-10-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10S,13S,14S)-13-(1-methoxyethyl)-10-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 69133264 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (8R,9S,10S,13S,14S)-13-(1-methoxyethyl)-10-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | COC(C)[C@]12CC[C@H]3[C@@H](CCC4CCCC[C@@]43C)[C@@H]1CCC2=O |
| InChI | InChI=1S/C21H34O2/c1-14(23-3)21-13-11-17-16(18(21)9-10-19(21)22)8-7-15-6-4-5-12-20(15,17)2/h14-18H,4-13H2,1-3H3/t14?,15?,16-,17+,18+,20+,21-/m1/s1 |
| InChIKey | YDFTUQHVDXYLLI-SVFYWSSXSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |