C20H32O2 — CID 125027872
(5R,8S,9R,10R,13R,14R,15R)-15-methoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 125027872) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (5R,8S,9R,10R,13R,14R,15R)-15-methoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (5R,8S,9R,10R,13R,14R,15R)-15-methoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 125027872 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (5R,8S,9R,10R,13R,14R,15R)-15-methoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CO[C@@H]1CC(=O)[C@]2(C)CC[C@@H]3[C@H](CC[C@H]4CCCC[C@]43C)[C@@H]12 |
| InChI | InChI=1S/C20H32O2/c1-19-10-5-4-6-13(19)7-8-14-15(19)9-11-20(2)17(21)12-16(22-3)18(14)20/h13-16,18H,4-12H2,1-3H3/t13-,14+,15-,16-,18+,19-,20+/m1/s1 |
| InChIKey | GWAKYNSFMRTRCV-YAGVAZRSSA-N |
| XLogP | 4.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |