C19H29NO3 — CID 134917921
(4aS,4bR,6aR,10aS,10bR,12aS)-2-hydroxy-10a,12a-dimethyl-4a,4b,5,6,6a,7,8,9,10,10b,11,12-dodecahydro-4H-naphtho[2,1-f]isoquinoline-1,3-dione (PubChem CID 134917921) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is (4aS,4bR,6aR,10aS,10bR,12aS)-2-hydroxy-10a,12a-dimethyl-4a,4b,5,6,6a,7,8,9,10,10b,11,12-dodecahydro-4H-naphtho[2,1-f]isoquinoline-1,3-dione.
| Compound Name | (4aS,4bR,6aR,10aS,10bR,12aS)-2-hydroxy-10a,12a-dimethyl-4a,4b,5,6,6a,7,8,9,10,10b,11,12-dodecahydro-4H-naphtho[2,1-f]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 134917921 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (4aS,4bR,6aR,10aS,10bR,12aS)-2-hydroxy-10a,12a-dimethyl-4a,4b,5,6,6a,7,8,9,10,10b,11,12-dodecahydro-4H-naphtho[2,1-f]isoquinoline-1,3-dione |
| SMILES | C[C@]12CCCC[C@@H]1CC[C@@H]1[C@H]2CC[C@]2(C)C(=O)N(O)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C19H29NO3/c1-18-9-4-3-5-12(18)6-7-13-14(18)8-10-19(2)15(13)11-16(21)20(23)17(19)22/h12-15,23H,3-11H2,1-2H3/t12-,13-,14-,15+,18+,19+/m1/s1 |
| InChIKey | PGMINDVZQUCGDC-MPQCEYCISA-N |
| XLogP | 3.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|