C22H32O3 — CID 91044489
[(8R,9R,10S,13S,14S)-10,13-dimethyl-17-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-ylidene]methyl acetate (PubChem CID 91044489) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(8R,9R,10S,13S,14S)-10,13-dimethyl-17-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-ylidene]methyl acetate.
| Compound Name | [(8R,9R,10S,13S,14S)-10,13-dimethyl-17-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-ylidene]methyl acetate |
|---|---|
| PubChem CID | 91044489 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(8R,9R,10S,13S,14S)-10,13-dimethyl-17-oxo-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-ylidene]methyl acetate |
| SMILES | CC(=O)OC=C1C[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C22H32O3/c1-14(23)25-13-15-12-19-17-8-7-16-6-4-5-10-21(16,2)18(17)9-11-22(19,3)20(15)24/h13,16-19H,4-12H2,1-3H3/t16?,17-,18-,19+,21+,22+/m1/s1 |
| InChIKey | AGODKRAIMMEROT-YLOYAAGTSA-N |
| XLogP | 5.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|