C20H31BrO — CID 67650259
(8R,9R,10S,13S,14S)-16-bromo-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 67650259) has the molecular formula C20H31BrO and a molecular weight of 367.37 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-16-bromo-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9R,10S,13S,14S)-16-bromo-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 67650259 |
| Molecular Formula | C20H31BrO |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (8R,9R,10S,13S,14S)-16-bromo-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC1(Br)C[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C20H31BrO/c1-18-10-5-4-6-13(18)7-8-14-15(18)9-11-19(2)16(14)12-20(3,21)17(19)22/h13-16H,4-12H2,1-3H3/t13?,14-,15-,16+,18+,19+,20?/m1/s1 |
| InChIKey | QOHVSXGWWMVNAK-BNFTVFKWSA-N |
| XLogP | 5.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|