C24H38O — CID 22295001
(5S,9R,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-1,2,3,4,5,6,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-12-one (PubChem CID 22295001) has the molecular formula C24H38O and a molecular weight of 342.57 g/mol. Its IUPAC name is (5S,9R,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-1,2,3,4,5,6,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-12-one.
| Compound Name | (5S,9R,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-1,2,3,4,5,6,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-12-one |
|---|---|
| PubChem CID | 22295001 |
| Molecular Formula | C24H38O |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | (5S,9R,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-1,2,3,4,5,6,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-12-one |
| SMILES | CCC[C@@H](C)[C@H]1CC[C@H]2C3=CC[C@@H]4CCCC[C@]4(C)[C@H]3CC(=O)[C@]12C |
| InChI | InChI=1S/C24H38O/c1-5-8-16(2)19-12-13-20-18-11-10-17-9-6-7-14-23(17,3)21(18)15-22(25)24(19,20)4/h11,16-17,19-21H,5-10,12-15H2,1-4H3/t16-,17+,19-,20+,21+,23+,24-/m1/s1 |
| InChIKey | JNSGQGNGPMYRSB-FTLZCDAUSA-N |
| XLogP | 6.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|