C27H44O — CID 93232982
(3aS,3bS,5aR,6R,8aR,10aS)-6-[(2R,5S)-5,6-dimethylheptan-2-yl]-3a,5a-dimethyl-3,3b,4,5,6,7,8,8a,10,10a-decahydro-1H-indeno[5,4-e]inden-2-one (PubChem CID 93232982) has the molecular formula C27H44O and a molecular weight of 384.65 g/mol. Its IUPAC name is (3aS,3bS,5aR,6R,8aR,10aS)-6-[(2R,5S)-5,6-dimethylheptan-2-yl]-3a,5a-dimethyl-3,3b,4,5,6,7,8,8a,10,10a-decahydro-1H-indeno[5,4-e]inden-2-one.
| Compound Name | (3aS,3bS,5aR,6R,8aR,10aS)-6-[(2R,5S)-5,6-dimethylheptan-2-yl]-3a,5a-dimethyl-3,3b,4,5,6,7,8,8a,10,10a-decahydro-1H-indeno[5,4-e]inden-2-one |
|---|---|
| PubChem CID | 93232982 |
| Molecular Formula | C27H44O |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 384.34 |
| IUPAC Name | (3aS,3bS,5aR,6R,8aR,10aS)-6-[(2R,5S)-5,6-dimethylheptan-2-yl]-3a,5a-dimethyl-3,3b,4,5,6,7,8,8a,10,10a-decahydro-1H-indeno[5,4-e]inden-2-one |
| SMILES | CC(C)[C@@H](C)CC[C@@H](C)[C@H]1CC[C@H]2C3=CC[C@H]4CC(=O)C[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C27H44O/c1-17(2)18(3)7-8-19(4)23-11-12-24-22-10-9-20-15-21(28)16-27(20,6)25(22)13-14-26(23,24)5/h10,17-20,23-25H,7-9,11-16H2,1-6H3/t18-,19+,20-,23+,24-,25+,26+,27-/m0/s1 |
| InChIKey | LBFOECKXTQFXNG-UXODUQRZSA-N |
| XLogP | 7.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|