C28H46O4 — CID 125031985
2-[(3S,3aS,5aS,6S,7S,9bS)-6-(carboxymethyl)-3-[(2R,5S)-5,6-dimethylheptan-2-yl]-3a,6-dimethyl-2,3,4,5,5a,7,8,9b-octahydro-1H-cyclopenta[a]naphthalen-7-yl]acetic acid (PubChem CID 125031985) has the molecular formula C28H46O4 and a molecular weight of 446.67 g/mol. Its IUPAC name is 2-[(3S,3aS,5aS,6S,7S,9bS)-6-(carboxymethyl)-3-[(2R,5S)-5,6-dimethylheptan-2-yl]-3a,6-dimethyl-2,3,4,5,5a,7,8,9b-octahydro-1H-cyclopenta[a]naphthalen-7-yl]acetic acid.
| Compound Name | 2-[(3S,3aS,5aS,6S,7S,9bS)-6-(carboxymethyl)-3-[(2R,5S)-5,6-dimethylheptan-2-yl]-3a,6-dimethyl-2,3,4,5,5a,7,8,9b-octahydro-1H-cyclopenta[a]naphthalen-7-yl]acetic acid |
|---|---|
| PubChem CID | 125031985 |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | 2-[(3S,3aS,5aS,6S,7S,9bS)-6-(carboxymethyl)-3-[(2R,5S)-5,6-dimethylheptan-2-yl]-3a,6-dimethyl-2,3,4,5,5a,7,8,9b-octahydro-1H-cyclopenta[a]naphthalen-7-yl]acetic acid |
| SMILES | CC(C)[C@@H](C)CC[C@@H](C)[C@@H]1CC[C@@H]2C3=CC[C@@H](CC(=O)O)[C@](C)(CC(=O)O)[C@@H]3CC[C@]21C |
| InChI | InChI=1S/C28H46O4/c1-17(2)18(3)7-8-19(4)22-11-12-23-21-10-9-20(15-25(29)30)28(6,16-26(31)32)24(21)13-14-27(22,23)5/h10,17-20,22-24H,7-9,11-16H2,1-6H3,(H,29,30)(H,31,32)/t18-,19+,20-,22-,23+,24+,27-,28-/m0/s1 |
| InChIKey | UBZMQZYNZYTSBT-JUMDQMMVSA-N |
| XLogP | 7.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|