C29H46O2 — CID 125032088
(2Z,5S,9R,10S,13R,14S,17S)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-2-(hydroxymethylidene)-10,13-dimethyl-4,5,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 125032088) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is (2Z,5S,9R,10S,13R,14S,17S)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-2-(hydroxymethylidene)-10,13-dimethyl-4,5,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (2Z,5S,9R,10S,13R,14S,17S)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-2-(hydroxymethylidene)-10,13-dimethyl-4,5,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 125032088 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | (2Z,5S,9R,10S,13R,14S,17S)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-2-(hydroxymethylidene)-10,13-dimethyl-4,5,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)[C@@H](C)CC[C@@H](C)[C@@H]1CC[C@@H]2C3=CC[C@H]4CC(=O)/C(=C\O)C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C29H46O2/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-22-15-27(31)21(17-30)16-29(22,6)26(23)13-14-28(24,25)5/h10,17-20,22,24-26,30H,7-9,11-16H2,1-6H3/b21-17-/t19-,20+,22-,24-,25+,26-,28+,29-/m0/s1 |
| InChIKey | UXGWFWJQNSRBBQ-QQABTQGOSA-N |
| XLogP | 7.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|