C19H26O3 — CID 66825378
(8R,9S,10R,13S)-10-(hydroxymethyl)-13-methyl-2,3,4,5,6,7,8,9,11,12-decahydro-1H-cyclopenta[a]phenanthrene-16,17-dione (PubChem CID 66825378) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (8R,9S,10R,13S)-10-(hydroxymethyl)-13-methyl-2,3,4,5,6,7,8,9,11,12-decahydro-1H-cyclopenta[a]phenanthrene-16,17-dione.
| Compound Name | (8R,9S,10R,13S)-10-(hydroxymethyl)-13-methyl-2,3,4,5,6,7,8,9,11,12-decahydro-1H-cyclopenta[a]phenanthrene-16,17-dione |
|---|---|
| PubChem CID | 66825378 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (8R,9S,10R,13S)-10-(hydroxymethyl)-13-methyl-2,3,4,5,6,7,8,9,11,12-decahydro-1H-cyclopenta[a]phenanthrene-16,17-dione |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4CCCC[C@@]43CO)C1=CC(=O)C2=O |
| InChI | InChI=1S/C19H26O3/c1-18-9-7-14-13(15(18)10-16(21)17(18)22)6-5-12-4-2-3-8-19(12,14)11-20/h10,12-14,20H,2-9,11H2,1H3/t12?,13-,14+,18+,19-/m1/s1 |
| InChIKey | SXCZSPLHULPGKD-HXQTXUCGSA-N |
| XLogP | 3.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|