C25H35NO4 — CID 154477490
6-[(8R,9S,10S,13R,17S)-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-4,6-dioxohexanamide (PubChem CID 154477490) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is 6-[(8R,9S,10S,13R,17S)-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-4,6-dioxohexanamide.
| Compound Name | 6-[(8R,9S,10S,13R,17S)-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-4,6-dioxohexanamide |
|---|---|
| PubChem CID | 154477490 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 6-[(8R,9S,10S,13R,17S)-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-4,6-dioxohexanamide |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4CCCC[C@@]43C)C1=CC(=O)[C@@H]2C(=O)CC(=O)CCC(N)=O |
| InChI | InChI=1S/C25H35NO4/c1-24-11-4-3-5-15(24)6-8-17-18(24)10-12-25(2)19(17)14-21(29)23(25)20(28)13-16(27)7-9-22(26)30/h14-15,17-18,23H,3-13H2,1-2H3,(H2,26,30)/t15?,17-,18+,23+,24+,25+/m1/s1 |
| InChIKey | IQPVNVWXFWYDTO-OFQJRDFUSA-N |
| XLogP | 3.93 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|