C12H18O2 — CID 98134055
(1S,2S,7S,9S)-2-hydroxytricyclo[7.2.1.02,7]dodecan-12-one (PubChem CID 98134055) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (1S,2S,7S,9S)-2-hydroxytricyclo[7.2.1.02,7]dodecan-12-one.
| Compound Name | (1S,2S,7S,9S)-2-hydroxytricyclo[7.2.1.02,7]dodecan-12-one |
|---|---|
| PubChem CID | 98134055 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (1S,2S,7S,9S)-2-hydroxytricyclo[7.2.1.02,7]dodecan-12-one |
| SMILES | O=C1[C@H]2CC[C@H]1[C@]1(O)CCCC[C@H]1C2 |
| InChI | InChI=1S/C12H18O2/c13-11-8-4-5-10(11)12(14)6-2-1-3-9(12)7-8/h8-10,14H,1-7H2/t8-,9-,10+,12-/m0/s1 |
| InChIKey | PWRLGIOYYQIRCE-GUDRVLHUSA-N |
| XLogP | 1.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |