C9H14O2 — CID 102498911
(1S,7S)-7-ethyl-1-hydroxybicyclo[3.2.0]heptan-6-one (PubChem CID 102498911) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (1S,7S)-7-ethyl-1-hydroxybicyclo[3.2.0]heptan-6-one.
| Compound Name | (1S,7S)-7-ethyl-1-hydroxybicyclo[3.2.0]heptan-6-one |
|---|---|
| PubChem CID | 102498911 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (1S,7S)-7-ethyl-1-hydroxybicyclo[3.2.0]heptan-6-one |
| SMILES | CC[C@@H]1C(=O)C2CCC[C@@]21O |
| InChI | InChI=1S/C9H14O2/c1-2-6-8(10)7-4-3-5-9(6,7)11/h6-7,11H,2-5H2,1H3/t6-,7?,9+/m1/s1 |
| InChIKey | DSNURGLHVRNQHL-YUTBPMSOSA-N |
| XLogP | 1.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |