C16H30O — CID 64754170
1-(2-ethylcyclohexyl)-2,3-dimethylcyclohexan-1-ol (PubChem CID 64754170) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is 1-(2-ethylcyclohexyl)-2,3-dimethylcyclohexan-1-ol.
| Compound Name | 1-(2-ethylcyclohexyl)-2,3-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 64754170 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 1-(2-ethylcyclohexyl)-2,3-dimethylcyclohexan-1-ol |
| SMILES | CCC1CCCCC1C1(O)CCCC(C)C1C |
| InChI | InChI=1S/C16H30O/c1-4-14-9-5-6-10-15(14)16(17)11-7-8-12(2)13(16)3/h12-15,17H,4-11H2,1-3H3 |
| InChIKey | GGLOTBOFURUYLZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |